C21H21FN6O2 — CID 130362471
4-[[(3S)-1-cyanopyrrolidin-3-yl]amino]-3-fluoro-7-N,7-N-dimethyl-9H-carbazole-1,7-dicarboxamide (PubChem CID 130362471) has the molecular formula C21H21FN6O2 and a molecular weight of 408.44 g/mol. Its IUPAC name is 4-[[(3S)-1-cyanopyrrolidin-3-yl]amino]-3-fluoro-7-N,7-N-dimethyl-9H-carbazole-1,7-dicarboxamide.
| Compound Name | 4-[[(3S)-1-cyanopyrrolidin-3-yl]amino]-3-fluoro-7-N,7-N-dimethyl-9H-carbazole-1,7-dicarboxamide |
|---|---|
| PubChem CID | 130362471 |
| Molecular Formula | C21H21FN6O2 |
| Molecular Weight | 408.44 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 4-[[(3S)-1-cyanopyrrolidin-3-yl]amino]-3-fluoro-7-N,7-N-dimethyl-9H-carbazole-1,7-dicarboxamide |
| SMILES | CN(C)C(=O)c1ccc2c(c1)[nH]c1c(C(N)=O)cc(F)c(N[C@H]3CCN(C#N)C3)c12 |
| InChI | InChI=1S/C21H21FN6O2/c1-27(2)21(30)11-3-4-13-16(7-11)26-18-14(20(24)29)8-15(22)19(17(13)18)25-12-5-6-28(9-12)10-23/h3-4,7-8,12,25-26H,5-6,9H2,1-2H3,(H2,24,29)/t12-/m0/s1 |
| InChIKey | PCDKUVLETCXEQZ-LBPRGKRZSA-N |
| XLogP | 2.23 |
| TPSA | 118.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.44 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|