C28H33FN6O2 — CID 130362514
4-[(3S)-3-(but-2-ynylamino)piperidin-1-yl]-3-fluoro-7-(4-methylpiperazine-1-carbonyl)-9H-carbazole-1-carboxamide (PubChem CID 130362514) has the molecular formula C28H33FN6O2 and a molecular weight of 504.61 g/mol. Its IUPAC name is 4-[(3S)-3-(but-2-ynylamino)piperidin-1-yl]-3-fluoro-7-(4-methylpiperazine-1-carbonyl)-9H-carbazole-1-carboxamide.
| Compound Name | 4-[(3S)-3-(but-2-ynylamino)piperidin-1-yl]-3-fluoro-7-(4-methylpiperazine-1-carbonyl)-9H-carbazole-1-carboxamide |
|---|---|
| PubChem CID | 130362514 |
| Molecular Formula | C28H33FN6O2 |
| Molecular Weight | 504.61 g/mol |
| Exact Mass | 504.26 |
| IUPAC Name | 4-[(3S)-3-(but-2-ynylamino)piperidin-1-yl]-3-fluoro-7-(4-methylpiperazine-1-carbonyl)-9H-carbazole-1-carboxamide |
| SMILES | CC#CCN[C@H]1CCCN(c2c(F)cc(C(N)=O)c3[nH]c4cc(C(=O)N5CCN(C)CC5)ccc4c23)C1 |
| InChI | InChI=1S/C28H33FN6O2/c1-3-4-9-31-19-6-5-10-35(17-19)26-22(29)16-21(27(30)36)25-24(26)20-8-7-18(15-23(20)32-25)28(37)34-13-11-33(2)12-14-34/h7-8,15-16,19,31-32H,5-6,9-14,17H2,1-2H3,(H2,30,36)/t19-/m0/s1 |
| InChIKey | PGTYVKWFGDDFPH-IBGZPJMESA-N |
| XLogP | 2.53 |
| TPSA | 97.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.61 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|