C23H22F4N4O2 — CID 139336158
N-[(3R)-1-[1-[amino(hydroxy)methyl]-3-fluoro-7-(trifluoromethyl)-9H-carbazol-4-yl]piperidin-3-yl]but-2-ynamide (PubChem CID 139336158) has the molecular formula C23H22F4N4O2 and a molecular weight of 462.45 g/mol. Its IUPAC name is N-[(3R)-1-[1-[amino(hydroxy)methyl]-3-fluoro-7-(trifluoromethyl)-9H-carbazol-4-yl]piperidin-3-yl]but-2-ynamide.
| Compound Name | N-[(3R)-1-[1-[amino(hydroxy)methyl]-3-fluoro-7-(trifluoromethyl)-9H-carbazol-4-yl]piperidin-3-yl]but-2-ynamide |
|---|---|
| PubChem CID | 139336158 |
| Molecular Formula | C23H22F4N4O2 |
| Molecular Weight | 462.45 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | N-[(3R)-1-[1-[amino(hydroxy)methyl]-3-fluoro-7-(trifluoromethyl)-9H-carbazol-4-yl]piperidin-3-yl]but-2-ynamide |
| SMILES | CC#CC(=O)N[C@@H]1CCCN(c2c(F)cc(C(N)O)c3[nH]c4cc(C(F)(F)F)ccc4c23)C1 |
| InChI | InChI=1S/C23H22F4N4O2/c1-2-4-18(32)29-13-5-3-8-31(11-13)21-16(24)10-15(22(28)33)20-19(21)14-7-6-12(23(25,26)27)9-17(14)30-20/h6-7,9-10,13,22,30,33H,3,5,8,11,28H2,1H3,(H,29,32)/t13-,22?/m1/s1 |
| InChIKey | UUINWKPWNVDYMM-BXWDTWGJSA-N |
| XLogP | 3.54 |
| TPSA | 94.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.45 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|