C21H25N3O2 — CID 147779324
7-[(3S)-3-(but-2-ynoylamino)piperidin-1-yl]-1,2-dimethyl-3H-indene-4-carboxamide (PubChem CID 147779324) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is 7-[(3S)-3-(but-2-ynoylamino)piperidin-1-yl]-1,2-dimethyl-3H-indene-4-carboxamide.
| Compound Name | 7-[(3S)-3-(but-2-ynoylamino)piperidin-1-yl]-1,2-dimethyl-3H-indene-4-carboxamide |
|---|---|
| PubChem CID | 147779324 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | 7-[(3S)-3-(but-2-ynoylamino)piperidin-1-yl]-1,2-dimethyl-3H-indene-4-carboxamide |
| SMILES | CC#CC(=O)N[C@H]1CCCN(c2ccc(C(N)=O)c3c2C(C)=C(C)C3)C1 |
| InChI | InChI=1S/C21H25N3O2/c1-4-6-19(25)23-15-7-5-10-24(12-15)18-9-8-16(21(22)26)17-11-13(2)14(3)20(17)18/h8-9,15H,5,7,10-12H2,1-3H3,(H2,22,26)(H,23,25)/t15-/m0/s1 |
| InChIKey | HHMBQCDUYOUNRX-HNNXBMFYSA-N |
| XLogP | 2.24 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|