C20H23N3O2 — CID 146896327
1,2-dimethyl-7-[(3S)-3-(prop-2-ynoylamino)piperidin-1-yl]-3H-indene-4-carboxamide (PubChem CID 146896327) has the molecular formula C20H23N3O2 and a molecular weight of 337.42 g/mol. Its IUPAC name is 1,2-dimethyl-7-[(3S)-3-(prop-2-ynoylamino)piperidin-1-yl]-3H-indene-4-carboxamide.
| Compound Name | 1,2-dimethyl-7-[(3S)-3-(prop-2-ynoylamino)piperidin-1-yl]-3H-indene-4-carboxamide |
|---|---|
| PubChem CID | 146896327 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | 1,2-dimethyl-7-[(3S)-3-(prop-2-ynoylamino)piperidin-1-yl]-3H-indene-4-carboxamide |
| SMILES | C#CC(=O)N[C@H]1CCCN(c2ccc(C(N)=O)c3c2C(C)=C(C)C3)C1 |
| InChI | InChI=1S/C20H23N3O2/c1-4-18(24)22-14-6-5-9-23(11-14)17-8-7-15(20(21)25)16-10-12(2)13(3)19(16)17/h1,7-8,14H,5-6,9-11H2,2-3H3,(H2,21,25)(H,22,24)/t14-/m0/s1 |
| InChIKey | UBOJJRJIPPAWIL-AWEZNQCLSA-N |
| XLogP | 1.85 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|