C19H20FN5O2 — CID 145069415
4-amino-3-fluoro-7-(4-methylpiperazine-1-carbonyl)-9H-carbazole-1-carboxamide (PubChem CID 145069415) has the molecular formula C19H20FN5O2 and a molecular weight of 369.40 g/mol. Its IUPAC name is 4-amino-3-fluoro-7-(4-methylpiperazine-1-carbonyl)-9H-carbazole-1-carboxamide.
| Compound Name | 4-amino-3-fluoro-7-(4-methylpiperazine-1-carbonyl)-9H-carbazole-1-carboxamide |
|---|---|
| PubChem CID | 145069415 |
| Molecular Formula | C19H20FN5O2 |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | 4-amino-3-fluoro-7-(4-methylpiperazine-1-carbonyl)-9H-carbazole-1-carboxamide |
| SMILES | CN1CCN(C(=O)c2ccc3c(c2)[nH]c2c(C(N)=O)cc(F)c(N)c23)CC1 |
| InChI | InChI=1S/C19H20FN5O2/c1-24-4-6-25(7-5-24)19(27)10-2-3-11-14(8-10)23-17-12(18(22)26)9-13(20)16(21)15(11)17/h2-3,8-9,23H,4-7,21H2,1H3,(H2,22,26) |
| InChIKey | PALBEDSCNJHUGG-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 108.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|