C18H16FN3O — CID 130362309
3-fluoro-4-(1,2,3,4-tetrahydropyridin-5-yl)-9H-carbazole-1-carboxamide (PubChem CID 130362309) has the molecular formula C18H16FN3O and a molecular weight of 309.34 g/mol. Its IUPAC name is 3-fluoro-4-(1,2,3,4-tetrahydropyridin-5-yl)-9H-carbazole-1-carboxamide.
| Compound Name | 3-fluoro-4-(1,2,3,4-tetrahydropyridin-5-yl)-9H-carbazole-1-carboxamide |
|---|---|
| PubChem CID | 130362309 |
| Molecular Formula | C18H16FN3O |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 3-fluoro-4-(1,2,3,4-tetrahydropyridin-5-yl)-9H-carbazole-1-carboxamide |
| SMILES | NC(=O)c1cc(F)c(C2=CNCCC2)c2c1[nH]c1ccccc12 |
| InChI | InChI=1S/C18H16FN3O/c19-13-8-12(18(20)23)17-16(11-5-1-2-6-14(11)22-17)15(13)10-4-3-7-21-9-10/h1-2,5-6,8-9,21-22H,3-4,7H2,(H2,20,23) |
| InChIKey | XGPZNGQLLBYCCM-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |