C21H16FN3O — CID 130362497
4-(2,3-dihydro-1H-indol-4-yl)-3-fluoro-9H-carbazole-1-carboxamide (PubChem CID 130362497) has the molecular formula C21H16FN3O and a molecular weight of 345.38 g/mol. Its IUPAC name is 4-(2,3-dihydro-1H-indol-4-yl)-3-fluoro-9H-carbazole-1-carboxamide.
| Compound Name | 4-(2,3-dihydro-1H-indol-4-yl)-3-fluoro-9H-carbazole-1-carboxamide |
|---|---|
| PubChem CID | 130362497 |
| Molecular Formula | C21H16FN3O |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | 4-(2,3-dihydro-1H-indol-4-yl)-3-fluoro-9H-carbazole-1-carboxamide |
| SMILES | NC(=O)c1cc(F)c(-c2cccc3c2CCN3)c2c1[nH]c1ccccc12 |
| InChI | InChI=1S/C21H16FN3O/c22-15-10-14(21(23)26)20-19(13-4-1-2-6-17(13)25-20)18(15)12-5-3-7-16-11(12)8-9-24-16/h1-7,10,24-25H,8-9H2,(H2,23,26) |
| InChIKey | OWUWHOSPSFJPRS-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |