C25H29FN4O3 — CID 130362479
tert-butyl 5-(1-carbamoyl-3-fluoro-9H-carbazol-4-yl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridine-1-carboxylate (PubChem CID 130362479) has the molecular formula C25H29FN4O3 and a molecular weight of 452.53 g/mol. Its IUPAC name is tert-butyl 5-(1-carbamoyl-3-fluoro-9H-carbazol-4-yl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridine-1-carboxylate.
| Compound Name | tert-butyl 5-(1-carbamoyl-3-fluoro-9H-carbazol-4-yl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridine-1-carboxylate |
|---|---|
| PubChem CID | 130362479 |
| Molecular Formula | C25H29FN4O3 |
| Molecular Weight | 452.53 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | tert-butyl 5-(1-carbamoyl-3-fluoro-9H-carbazol-4-yl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2CN(c3c(F)cc(C(N)=O)c4[nH]c5ccccc5c34)CCC21 |
| InChI | InChI=1S/C25H29FN4O3/c1-25(2,3)33-24(32)30-11-8-14-13-29(10-9-19(14)30)22-17(26)12-16(23(27)31)21-20(22)15-6-4-5-7-18(15)28-21/h4-7,12,14,19,28H,8-11,13H2,1-3H3,(H2,27,31) |
| InChIKey | ADQGNDCXHLQFGR-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 91.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.53 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |