C23H32ClFN4O3 — CID 170003172
tert-butyl 6-[7-(aminomethoxymethyl)-3-chloro-5-fluoro-2-methyl-1H-indol-4-yl]-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridine-1-carboxylate (PubChem CID 170003172) has the molecular formula C23H32ClFN4O3 and a molecular weight of 466.99 g/mol. Its IUPAC name is tert-butyl 6-[7-(aminomethoxymethyl)-3-chloro-5-fluoro-2-methyl-1H-indol-4-yl]-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridine-1-carboxylate.
| Compound Name | tert-butyl 6-[7-(aminomethoxymethyl)-3-chloro-5-fluoro-2-methyl-1H-indol-4-yl]-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridine-1-carboxylate |
|---|---|
| PubChem CID | 170003172 |
| Molecular Formula | C23H32ClFN4O3 |
| Molecular Weight | 466.99 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | tert-butyl 6-[7-(aminomethoxymethyl)-3-chloro-5-fluoro-2-methyl-1H-indol-4-yl]-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridine-1-carboxylate |
| SMILES | Cc1[nH]c2c(COCN)cc(F)c(N3CCC4CCN(C(=O)OC(C)(C)C)C4C3)c2c1Cl |
| InChI | InChI=1S/C23H32ClFN4O3/c1-13-19(24)18-20(27-13)15(11-31-12-26)9-16(25)21(18)28-7-5-14-6-8-29(17(14)10-28)22(30)32-23(2,3)4/h9,14,17,27H,5-8,10-12,26H2,1-4H3 |
| InChIKey | NMENMQWOWUKQSQ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 83.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.99 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|