C17H22BrClN2O2 — CID 170961242
tert-butyl (3aR,6aR)-5-(2-bromo-4-chlorophenyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-1-carboxylate (PubChem CID 170961242) has the molecular formula C17H22BrClN2O2 and a molecular weight of 401.73 g/mol. Its IUPAC name is tert-butyl (3aR,6aR)-5-(2-bromo-4-chlorophenyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-1-carboxylate.
| Compound Name | tert-butyl (3aR,6aR)-5-(2-bromo-4-chlorophenyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 170961242 |
| Molecular Formula | C17H22BrClN2O2 |
| Molecular Weight | 401.73 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | tert-butyl (3aR,6aR)-5-(2-bromo-4-chlorophenyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H]2CN(c3ccc(Cl)cc3Br)C[C@@H]21 |
| InChI | InChI=1S/C17H22BrClN2O2/c1-17(2,3)23-16(22)21-7-6-11-9-20(10-15(11)21)14-5-4-12(19)8-13(14)18/h4-5,8,11,15H,6-7,9-10H2,1-3H3/t11-,15+/m1/s1 |
| InChIKey | UWGMRPDJZFFHEK-ABAIWWIYSA-N |
| XLogP | 4.55 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.73 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |