C27H28F3N3O4S — CID 68728985
tert-butyl 5-[3-[3-(trifluoromethyl)phenyl]sulfonylquinolin-8-yl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-1-carboxylate (PubChem CID 68728985) has the molecular formula C27H28F3N3O4S and a molecular weight of 547.60 g/mol. Its IUPAC name is tert-butyl 5-[3-[3-(trifluoromethyl)phenyl]sulfonylquinolin-8-yl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-1-carboxylate.
| Compound Name | tert-butyl 5-[3-[3-(trifluoromethyl)phenyl]sulfonylquinolin-8-yl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 68728985 |
| Molecular Formula | C27H28F3N3O4S |
| Molecular Weight | 547.60 g/mol |
| Exact Mass | 547.18 |
| IUPAC Name | tert-butyl 5-[3-[3-(trifluoromethyl)phenyl]sulfonylquinolin-8-yl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2CN(c3cccc4cc(S(=O)(=O)c5cccc(C(F)(F)F)c5)cnc34)CC21 |
| InChI | InChI=1S/C27H28F3N3O4S/c1-26(2,3)37-25(34)33-11-10-18-15-32(16-23(18)33)22-9-4-6-17-12-21(14-31-24(17)22)38(35,36)20-8-5-7-19(13-20)27(28,29)30/h4-9,12-14,18,23H,10-11,15-16H2,1-3H3 |
| InChIKey | KKJBETWPCXIPNG-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.60 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |