C22H20F3N3O2S — CID 25196622
8-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-yl)-3-[3-(trifluoromethyl)phenyl]sulfonylquinoline (PubChem CID 25196622) has the molecular formula C22H20F3N3O2S and a molecular weight of 447.48 g/mol. Its IUPAC name is 8-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-yl)-3-[3-(trifluoromethyl)phenyl]sulfonylquinoline.
| Compound Name | 8-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-yl)-3-[3-(trifluoromethyl)phenyl]sulfonylquinoline |
|---|---|
| PubChem CID | 25196622 |
| Molecular Formula | C22H20F3N3O2S |
| Molecular Weight | 447.48 g/mol |
| Exact Mass | 447.12 |
| IUPAC Name | 8-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-yl)-3-[3-(trifluoromethyl)phenyl]sulfonylquinoline |
| SMILES | O=S(=O)(c1cccc(C(F)(F)F)c1)c1cnc2c(N3CC4CCNC4C3)cccc2c1 |
| InChI | InChI=1S/C22H20F3N3O2S/c23-22(24,25)16-4-2-5-17(10-16)31(29,30)18-9-14-3-1-6-20(21(14)27-11-18)28-12-15-7-8-26-19(15)13-28/h1-6,9-11,15,19,26H,7-8,12-13H2 |
| InChIKey | AYWVDASBDPVTJZ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.48 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |