C21H19F3N2O3S — CID 130404359
(3S)-1-[3-[3-(trifluoromethyl)phenyl]sulfonylquinolin-8-yl]piperidin-3-ol (PubChem CID 130404359) has the molecular formula C21H19F3N2O3S and a molecular weight of 436.46 g/mol. Its IUPAC name is (3S)-1-[3-[3-(trifluoromethyl)phenyl]sulfonylquinolin-8-yl]piperidin-3-ol.
| Compound Name | (3S)-1-[3-[3-(trifluoromethyl)phenyl]sulfonylquinolin-8-yl]piperidin-3-ol |
|---|---|
| PubChem CID | 130404359 |
| Molecular Formula | C21H19F3N2O3S |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | (3S)-1-[3-[3-(trifluoromethyl)phenyl]sulfonylquinolin-8-yl]piperidin-3-ol |
| SMILES | O=S(=O)(c1cccc(C(F)(F)F)c1)c1cnc2c(N3CCC[C@H](O)C3)cccc2c1 |
| InChI | InChI=1S/C21H19F3N2O3S/c22-21(23,24)15-5-2-7-17(11-15)30(28,29)18-10-14-4-1-8-19(20(14)25-12-18)26-9-3-6-16(27)13-26/h1-2,4-5,7-8,10-12,16,27H,3,6,9,13H2/t16-/m0/s1 |
| InChIKey | NQLQTUMHRIQVEY-INIZCTEOSA-N |
| XLogP | 4.05 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |