C20H20N2O3S — CID 130404380
(3R)-1-[3-(benzenesulfonyl)quinolin-8-yl]piperidin-3-ol (PubChem CID 130404380) has the molecular formula C20H20N2O3S and a molecular weight of 368.46 g/mol. Its IUPAC name is (3R)-1-[3-(benzenesulfonyl)quinolin-8-yl]piperidin-3-ol.
| Compound Name | (3R)-1-[3-(benzenesulfonyl)quinolin-8-yl]piperidin-3-ol |
|---|---|
| PubChem CID | 130404380 |
| Molecular Formula | C20H20N2O3S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | (3R)-1-[3-(benzenesulfonyl)quinolin-8-yl]piperidin-3-ol |
| SMILES | O=S(=O)(c1ccccc1)c1cnc2c(N3CCC[C@@H](O)C3)cccc2c1 |
| InChI | InChI=1S/C20H20N2O3S/c23-16-7-5-11-22(14-16)19-10-4-6-15-12-18(13-21-20(15)19)26(24,25)17-8-2-1-3-9-17/h1-4,6,8-10,12-13,16,23H,5,7,11,14H2/t16-/m1/s1 |
| InChIKey | WAGKQZMEVTYMAE-MRXNPFEDSA-N |
| XLogP | 3.03 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |