C22H21FN4O2 — CID 130362418
6-fluoro-5-(1-prop-2-enoyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl)-9H-carbazole-4-carboxamide (PubChem CID 130362418) has the molecular formula C22H21FN4O2 and a molecular weight of 392.43 g/mol. Its IUPAC name is 6-fluoro-5-(1-prop-2-enoyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl)-9H-carbazole-4-carboxamide.
| Compound Name | 6-fluoro-5-(1-prop-2-enoyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl)-9H-carbazole-4-carboxamide |
|---|---|
| PubChem CID | 130362418 |
| Molecular Formula | C22H21FN4O2 |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 6-fluoro-5-(1-prop-2-enoyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl)-9H-carbazole-4-carboxamide |
| SMILES | C=CC(=O)N1CCC2CN(c3c(F)ccc4[nH]c5cccc(C(N)=O)c5c34)CC21 |
| InChI | InChI=1S/C22H21FN4O2/c1-2-18(28)27-9-8-12-10-26(11-17(12)27)21-14(23)6-7-16-20(21)19-13(22(24)29)4-3-5-15(19)25-16/h2-7,12,17,25H,1,8-11H2,(H2,24,29) |
| InChIKey | DECNVPOIEFBGIC-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|