C30H38FN5O4 — CID 145290125
tert-butyl 5-[3-(cyclobutanecarboximidoyl)-2-(4-fluoroanilino)-6-methoxycarbonyl-4-pyridinyl]-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridine-1-carboxylate (PubChem CID 145290125) has the molecular formula C30H38FN5O4 and a molecular weight of 551.66 g/mol. Its IUPAC name is tert-butyl 5-[3-(cyclobutanecarboximidoyl)-2-(4-fluoroanilino)-6-methoxycarbonyl-4-pyridinyl]-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridine-1-carboxylate.
| Compound Name | tert-butyl 5-[3-(cyclobutanecarboximidoyl)-2-(4-fluoroanilino)-6-methoxycarbonyl-4-pyridinyl]-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridine-1-carboxylate |
|---|---|
| PubChem CID | 145290125 |
| Molecular Formula | C30H38FN5O4 |
| Molecular Weight | 551.66 g/mol |
| Exact Mass | 551.29 |
| IUPAC Name | tert-butyl 5-[3-(cyclobutanecarboximidoyl)-2-(4-fluoroanilino)-6-methoxycarbonyl-4-pyridinyl]-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridine-1-carboxylate |
| SMILES | [H]/N=C(/c1c(N2CCC3C(CCN3C(=O)OC(C)(C)C)C2)cc(C(=O)OC)nc1Nc1ccc(F)cc1)C1CCC1 |
| InChI | InChI=1S/C30H38FN5O4/c1-30(2,3)40-29(38)36-15-12-19-17-35(14-13-23(19)36)24-16-22(28(37)39-4)34-27(25(24)26(32)18-6-5-7-18)33-21-10-8-20(31)9-11-21/h8-11,16,18-19,23,32H,5-7,12-15,17H2,1-4H3,(H,33,34)/b32-26+ |
| InChIKey | ALIQDIBWTOQOGS-HMZBKAONSA-N |
| XLogP | 5.75 |
| TPSA | 107.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.66 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|