C24H30N4O3 — CID 129024037
methyl 6-anilino-5-(cyclobutanecarboximidoyl)-4-(4-methoxypiperidin-1-yl)pyridine-2-carboxylate (PubChem CID 129024037) has the molecular formula C24H30N4O3 and a molecular weight of 422.53 g/mol. Its IUPAC name is methyl 6-anilino-5-(cyclobutanecarboximidoyl)-4-(4-methoxypiperidin-1-yl)pyridine-2-carboxylate.
| Compound Name | methyl 6-anilino-5-(cyclobutanecarboximidoyl)-4-(4-methoxypiperidin-1-yl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 129024037 |
| Molecular Formula | C24H30N4O3 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | methyl 6-anilino-5-(cyclobutanecarboximidoyl)-4-(4-methoxypiperidin-1-yl)pyridine-2-carboxylate |
| SMILES | [H]/N=C(/c1c(N2CCC(OC)CC2)cc(C(=O)OC)nc1Nc1ccccc1)C1CCC1 |
| InChI | InChI=1S/C24H30N4O3/c1-30-18-11-13-28(14-12-18)20-15-19(24(29)31-2)27-23(26-17-9-4-3-5-10-17)21(20)22(25)16-7-6-8-16/h3-5,9-10,15-16,18,25H,6-8,11-14H2,1-2H3,(H,26,27)/b25-22+ |
| InChIKey | NTIOGWFOIHWFNJ-YYDJUVGSSA-N |
| XLogP | 4.39 |
| TPSA | 87.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|