C26H34ClN5O3 — CID 129024227
ethyl 6-[(2-chloro-6-methyl-4-pyridinyl)amino]-5-(cyclobutanecarboximidoyl)-4-[4-(methoxymethyl)piperidin-1-yl]pyridine-2-carboxylate (PubChem CID 129024227) has the molecular formula C26H34ClN5O3 and a molecular weight of 500.04 g/mol. Its IUPAC name is ethyl 6-[(2-chloro-6-methyl-4-pyridinyl)amino]-5-(cyclobutanecarboximidoyl)-4-[4-(methoxymethyl)piperidin-1-yl]pyridine-2-carboxylate.
| Compound Name | ethyl 6-[(2-chloro-6-methyl-4-pyridinyl)amino]-5-(cyclobutanecarboximidoyl)-4-[4-(methoxymethyl)piperidin-1-yl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 129024227 |
| Molecular Formula | C26H34ClN5O3 |
| Molecular Weight | 500.04 g/mol |
| Exact Mass | 499.24 |
| IUPAC Name | ethyl 6-[(2-chloro-6-methyl-4-pyridinyl)amino]-5-(cyclobutanecarboximidoyl)-4-[4-(methoxymethyl)piperidin-1-yl]pyridine-2-carboxylate |
| SMILES | [H]/N=C(/c1c(N2CCC(COC)CC2)cc(C(=O)OCC)nc1Nc1cc(C)nc(Cl)c1)C1CCC1 |
| InChI | InChI=1S/C26H34ClN5O3/c1-4-35-26(33)20-14-21(32-10-8-17(9-11-32)15-34-3)23(24(28)18-6-5-7-18)25(31-20)30-19-12-16(2)29-22(27)13-19/h12-14,17-18,28H,4-11,15H2,1-3H3,(H,29,30,31)/b28-24+ |
| InChIKey | BRJSNXFOOVBLKO-ZZIIXHQDSA-N |
| XLogP | 5.39 |
| TPSA | 100.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.04 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|