C24H35N5O2 — CID 129033614
methyl 5-(cyclobutanecarboximidoyl)-6-[[(3E)-penta-1,3-dien-3-yl]amino]-4-(4-propan-2-ylpiperazin-1-yl)pyridine-2-carboxylate (PubChem CID 129033614) has the molecular formula C24H35N5O2 and a molecular weight of 425.58 g/mol. Its IUPAC name is methyl 5-(cyclobutanecarboximidoyl)-6-[[(3E)-penta-1,3-dien-3-yl]amino]-4-(4-propan-2-ylpiperazin-1-yl)pyridine-2-carboxylate.
| Compound Name | methyl 5-(cyclobutanecarboximidoyl)-6-[[(3E)-penta-1,3-dien-3-yl]amino]-4-(4-propan-2-ylpiperazin-1-yl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 129033614 |
| Molecular Formula | C24H35N5O2 |
| Molecular Weight | 425.58 g/mol |
| Exact Mass | 425.28 |
| IUPAC Name | methyl 5-(cyclobutanecarboximidoyl)-6-[[(3E)-penta-1,3-dien-3-yl]amino]-4-(4-propan-2-ylpiperazin-1-yl)pyridine-2-carboxylate |
| SMILES | [H]/N=C(/c1c(N2CCN(C(C)C)CC2)cc(C(=O)OC)nc1N/C(C=C)=C/C)C1CCC1 |
| InChI | InChI=1S/C24H35N5O2/c1-6-18(7-2)26-23-21(22(25)17-9-8-10-17)20(15-19(27-23)24(30)31-5)29-13-11-28(12-14-29)16(3)4/h6-7,15-17,25H,1,8-14H2,2-5H3,(H,26,27)/b18-7+,25-22+ |
| InChIKey | RHOAVLSZBDUILW-YKEDDLPOSA-N |
| XLogP | 4.07 |
| TPSA | 81.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.58 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|