C25H30N4O5 — CID 129023897
6-anilino-5-(cyclobutanecarboximidoyl)-4-[(1-methoxycarbonylpiperidin-4-yl)methoxy]pyridine-2-carboxylic acid (PubChem CID 129023897) has the molecular formula C25H30N4O5 and a molecular weight of 466.54 g/mol. Its IUPAC name is 6-anilino-5-(cyclobutanecarboximidoyl)-4-[(1-methoxycarbonylpiperidin-4-yl)methoxy]pyridine-2-carboxylic acid.
| Compound Name | 6-anilino-5-(cyclobutanecarboximidoyl)-4-[(1-methoxycarbonylpiperidin-4-yl)methoxy]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 129023897 |
| Molecular Formula | C25H30N4O5 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | 6-anilino-5-(cyclobutanecarboximidoyl)-4-[(1-methoxycarbonylpiperidin-4-yl)methoxy]pyridine-2-carboxylic acid |
| SMILES | [H]/N=C(/c1c(OCC2CCN(C(=O)OC)CC2)cc(C(=O)O)nc1Nc1ccccc1)C1CCC1 |
| InChI | InChI=1S/C25H30N4O5/c1-33-25(32)29-12-10-16(11-13-29)15-34-20-14-19(24(30)31)28-23(27-18-8-3-2-4-9-18)21(20)22(26)17-6-5-7-17/h2-4,8-9,14,16-17,26H,5-7,10-13,15H2,1H3,(H,27,28)(H,30,31)/b26-22+ |
| InChIKey | BATIZZBLDGORCD-XTCLZLMSSA-N |
| XLogP | 4.55 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|