C23H26FN3O4 — CID 129024316
5-(cyclobutanecarboximidoyl)-6-(4-fluoroanilino)-4-(oxan-4-ylmethoxy)pyridine-2-carboxylic acid (PubChem CID 129024316) has the molecular formula C23H26FN3O4 and a molecular weight of 427.48 g/mol. Its IUPAC name is 5-(cyclobutanecarboximidoyl)-6-(4-fluoroanilino)-4-(oxan-4-ylmethoxy)pyridine-2-carboxylic acid.
| Compound Name | 5-(cyclobutanecarboximidoyl)-6-(4-fluoroanilino)-4-(oxan-4-ylmethoxy)pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 129024316 |
| Molecular Formula | C23H26FN3O4 |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | 5-(cyclobutanecarboximidoyl)-6-(4-fluoroanilino)-4-(oxan-4-ylmethoxy)pyridine-2-carboxylic acid |
| SMILES | [H]/N=C(/c1c(OCC2CCOCC2)cc(C(=O)O)nc1Nc1ccc(F)cc1)C1CCC1 |
| InChI | InChI=1S/C23H26FN3O4/c24-16-4-6-17(7-5-16)26-22-20(21(25)15-2-1-3-15)19(12-18(27-22)23(28)29)31-13-14-8-10-30-11-9-14/h4-7,12,14-15,25H,1-3,8-11,13H2,(H,26,27)(H,28,29)/b25-21+ |
| InChIKey | ZASXYJRKIKQAHM-NJNXFGOHSA-N |
| XLogP | 4.64 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|