C19H20FNO4 — CID 167948143
5-[5-fluoro-2-(oxan-4-ylmethoxy)phenyl]-4-methylpyridine-3-carboxylic acid (PubChem CID 167948143) has the molecular formula C19H20FNO4 and a molecular weight of 345.37 g/mol. Its IUPAC name is 5-[5-fluoro-2-(oxan-4-ylmethoxy)phenyl]-4-methylpyridine-3-carboxylic acid.
| Compound Name | 5-[5-fluoro-2-(oxan-4-ylmethoxy)phenyl]-4-methylpyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 167948143 |
| Molecular Formula | C19H20FNO4 |
| Molecular Weight | 345.37 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | 5-[5-fluoro-2-(oxan-4-ylmethoxy)phenyl]-4-methylpyridine-3-carboxylic acid |
| SMILES | Cc1c(C(=O)O)cncc1-c1cc(F)ccc1OCC1CCOCC1 |
| InChI | InChI=1S/C19H20FNO4/c1-12-16(9-21-10-17(12)19(22)23)15-8-14(20)2-3-18(15)25-11-13-4-6-24-7-5-13/h2-3,8-10,13H,4-7,11H2,1H3,(H,22,23) |
| InChIKey | VVDMFHXDHKEINE-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.37 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |