C22H30N4O3 — CID 145290098
6-anilino-5-ethanimidoyl-4-(4-hydroxypiperidin-1-yl)pyridine-2-carbaldehyde;methoxyethane (PubChem CID 145290098) has the molecular formula C22H30N4O3 and a molecular weight of 398.51 g/mol. Its IUPAC name is 6-anilino-5-ethanimidoyl-4-(4-hydroxypiperidin-1-yl)pyridine-2-carbaldehyde;methoxyethane.
| Compound Name | 6-anilino-5-ethanimidoyl-4-(4-hydroxypiperidin-1-yl)pyridine-2-carbaldehyde;methoxyethane |
|---|---|
| PubChem CID | 145290098 |
| Molecular Formula | C22H30N4O3 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | 6-anilino-5-ethanimidoyl-4-(4-hydroxypiperidin-1-yl)pyridine-2-carbaldehyde;methoxyethane |
| SMILES | CCOC.[H]/N=C(\C)c1c(N2CCC(O)CC2)cc(C=O)nc1Nc1ccccc1 |
| InChI | InChI=1S/C19H22N4O2.C3H8O/c1-13(20)18-17(23-9-7-16(25)8-10-23)11-15(12-24)22-19(18)21-14-5-3-2-4-6-14;1-3-4-2/h2-6,11-12,16,20,25H,7-10H2,1H3,(H,21,22);3H2,1-2H3/b20-13+; |
| InChIKey | XDHKOHHJMGMHCA-UNUAAEKOSA-N |
| XLogP | 3.64 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|