C30H37N5O2 — CID 129033707
ethyl 6-anilino-4-[4-(4-tert-butylpiperazin-1-yl)phenyl]-5-ethanimidoylpyridine-2-carboxylate (PubChem CID 129033707) has the molecular formula C30H37N5O2 and a molecular weight of 499.66 g/mol. Its IUPAC name is ethyl 6-anilino-4-[4-(4-tert-butylpiperazin-1-yl)phenyl]-5-ethanimidoylpyridine-2-carboxylate.
| Compound Name | ethyl 6-anilino-4-[4-(4-tert-butylpiperazin-1-yl)phenyl]-5-ethanimidoylpyridine-2-carboxylate |
|---|---|
| PubChem CID | 129033707 |
| Molecular Formula | C30H37N5O2 |
| Molecular Weight | 499.66 g/mol |
| Exact Mass | 499.29 |
| IUPAC Name | ethyl 6-anilino-4-[4-(4-tert-butylpiperazin-1-yl)phenyl]-5-ethanimidoylpyridine-2-carboxylate |
| SMILES | [H]/N=C(\C)c1c(-c2ccc(N3CCN(C(C)(C)C)CC3)cc2)cc(C(=O)OCC)nc1Nc1ccccc1 |
| InChI | InChI=1S/C30H37N5O2/c1-6-37-29(36)26-20-25(27(21(2)31)28(33-26)32-23-10-8-7-9-11-23)22-12-14-24(15-13-22)34-16-18-35(19-17-34)30(3,4)5/h7-15,20,31H,6,16-19H2,1-5H3,(H,32,33)/b31-21+ |
| InChIKey | NXFRPZZOHDCEJS-NJZRLIGZSA-N |
| XLogP | 5.98 |
| TPSA | 81.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.66 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|