C28H36N6O3 — CID 129033597
ethyl 6-[[1-(cyanomethyl)pyrrolidin-3-yl]amino]-5-(2-methylpropanimidoyl)-4-(4-morpholin-4-ylphenyl)pyridine-2-carboxylate (PubChem CID 129033597) has the molecular formula C28H36N6O3 and a molecular weight of 504.64 g/mol. Its IUPAC name is ethyl 6-[[1-(cyanomethyl)pyrrolidin-3-yl]amino]-5-(2-methylpropanimidoyl)-4-(4-morpholin-4-ylphenyl)pyridine-2-carboxylate.
| Compound Name | ethyl 6-[[1-(cyanomethyl)pyrrolidin-3-yl]amino]-5-(2-methylpropanimidoyl)-4-(4-morpholin-4-ylphenyl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 129033597 |
| Molecular Formula | C28H36N6O3 |
| Molecular Weight | 504.64 g/mol |
| Exact Mass | 504.28 |
| IUPAC Name | ethyl 6-[[1-(cyanomethyl)pyrrolidin-3-yl]amino]-5-(2-methylpropanimidoyl)-4-(4-morpholin-4-ylphenyl)pyridine-2-carboxylate |
| SMILES | [H]/N=C(/c1c(-c2ccc(N3CCOCC3)cc2)cc(C(=O)OCC)nc1NC1CCN(CC#N)C1)C(C)C |
| InChI | InChI=1S/C28H36N6O3/c1-4-37-28(35)24-17-23(20-5-7-22(8-6-20)34-13-15-36-16-14-34)25(26(30)19(2)3)27(32-24)31-21-9-11-33(18-21)12-10-29/h5-8,17,19,21,30H,4,9,11-16,18H2,1-3H3,(H,31,32)/b30-26+ |
| InChIKey | DTUGCMVCIONQDV-URGPHPNLSA-N |
| XLogP | 3.80 |
| TPSA | 114.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.64 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|