C23H30N4O2 — CID 129033553
6-(1-ethoxyethenyl)-3-(2-methylpropanimidoyl)-4-(4-morpholin-4-ylphenyl)pyridin-2-amine (PubChem CID 129033553) has the molecular formula C23H30N4O2 and a molecular weight of 394.52 g/mol. Its IUPAC name is 6-(1-ethoxyethenyl)-3-(2-methylpropanimidoyl)-4-(4-morpholin-4-ylphenyl)pyridin-2-amine.
| Compound Name | 6-(1-ethoxyethenyl)-3-(2-methylpropanimidoyl)-4-(4-morpholin-4-ylphenyl)pyridin-2-amine |
|---|---|
| PubChem CID | 129033553 |
| Molecular Formula | C23H30N4O2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | 6-(1-ethoxyethenyl)-3-(2-methylpropanimidoyl)-4-(4-morpholin-4-ylphenyl)pyridin-2-amine |
| SMILES | [H]/N=C(/c1c(-c2ccc(N3CCOCC3)cc2)cc(C(=C)OCC)nc1N)C(C)C |
| InChI | InChI=1S/C23H30N4O2/c1-5-29-16(4)20-14-19(21(23(25)26-20)22(24)15(2)3)17-6-8-18(9-7-17)27-10-12-28-13-11-27/h6-9,14-15,24H,4-5,10-13H2,1-3H3,(H2,25,26)/b24-22+ |
| InChIKey | CGRLPIHQJWXPBV-ZNTNEXAZSA-N |
| XLogP | 4.20 |
| TPSA | 84.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|