C22H27ClN6O5 — CID 129055368
ethyl 2-[amino-[3-[[2-amino-5-chloro-6-(4-morpholin-4-ylphenyl)-3-pyridinyl]amino]-3-oxopropanoyl]amino]acetate (PubChem CID 129055368) has the molecular formula C22H27ClN6O5 and a molecular weight of 490.95 g/mol. Its IUPAC name is ethyl 2-[amino-[3-[[2-amino-5-chloro-6-(4-morpholin-4-ylphenyl)-3-pyridinyl]amino]-3-oxopropanoyl]amino]acetate.
| Compound Name | ethyl 2-[amino-[3-[[2-amino-5-chloro-6-(4-morpholin-4-ylphenyl)-3-pyridinyl]amino]-3-oxopropanoyl]amino]acetate |
|---|---|
| PubChem CID | 129055368 |
| Molecular Formula | C22H27ClN6O5 |
| Molecular Weight | 490.95 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | ethyl 2-[amino-[3-[[2-amino-5-chloro-6-(4-morpholin-4-ylphenyl)-3-pyridinyl]amino]-3-oxopropanoyl]amino]acetate |
| SMILES | CCOC(=O)CN(N)C(=O)CC(=O)Nc1cc(Cl)c(-c2ccc(N3CCOCC3)cc2)nc1N |
| InChI | InChI=1S/C22H27ClN6O5/c1-2-34-20(32)13-29(25)19(31)12-18(30)26-17-11-16(23)21(27-22(17)24)14-3-5-15(6-4-14)28-7-9-33-10-8-28/h3-6,11H,2,7-10,12-13,25H2,1H3,(H2,24,27)(H,26,30) |
| InChIKey | ILVUXWQCKLVMBT-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 153.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.95 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|