C22H31N5O2 — CID 129033621
ethyl 6-(cyclohexylamino)-5-(2-methylpropanimidoyl)-4-(2-methylpyrazol-3-yl)pyridine-2-carboxylate (PubChem CID 129033621) has the molecular formula C22H31N5O2 and a molecular weight of 397.52 g/mol. Its IUPAC name is ethyl 6-(cyclohexylamino)-5-(2-methylpropanimidoyl)-4-(2-methylpyrazol-3-yl)pyridine-2-carboxylate.
| Compound Name | ethyl 6-(cyclohexylamino)-5-(2-methylpropanimidoyl)-4-(2-methylpyrazol-3-yl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 129033621 |
| Molecular Formula | C22H31N5O2 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.25 |
| IUPAC Name | ethyl 6-(cyclohexylamino)-5-(2-methylpropanimidoyl)-4-(2-methylpyrazol-3-yl)pyridine-2-carboxylate |
| SMILES | [H]/N=C(/c1c(-c2ccnn2C)cc(C(=O)OCC)nc1NC1CCCCC1)C(C)C |
| InChI | InChI=1S/C22H31N5O2/c1-5-29-22(28)17-13-16(18-11-12-24-27(18)4)19(20(23)14(2)3)21(26-17)25-15-9-7-6-8-10-15/h11-15,23H,5-10H2,1-4H3,(H,25,26)/b23-20+ |
| InChIKey | FPMQOIZHYRYSDE-BSYVCWPDSA-N |
| XLogP | 4.43 |
| TPSA | 92.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|