C19H30N4O2 — CID 145290719
6-amino-4-[4-(methoxymethyl)piperidin-1-yl]-5-(2-methylpentanimidoyl)pyridine-2-carbaldehyde (PubChem CID 145290719) has the molecular formula C19H30N4O2 and a molecular weight of 346.48 g/mol. Its IUPAC name is 6-amino-4-[4-(methoxymethyl)piperidin-1-yl]-5-(2-methylpentanimidoyl)pyridine-2-carbaldehyde.
| Compound Name | 6-amino-4-[4-(methoxymethyl)piperidin-1-yl]-5-(2-methylpentanimidoyl)pyridine-2-carbaldehyde |
|---|---|
| PubChem CID | 145290719 |
| Molecular Formula | C19H30N4O2 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | 6-amino-4-[4-(methoxymethyl)piperidin-1-yl]-5-(2-methylpentanimidoyl)pyridine-2-carbaldehyde |
| SMILES | [H]/N=C(/c1c(N2CCC(COC)CC2)cc(C=O)nc1N)C(C)CCC |
| InChI | InChI=1S/C19H30N4O2/c1-4-5-13(2)18(20)17-16(10-15(11-24)22-19(17)21)23-8-6-14(7-9-23)12-25-3/h10-11,13-14,20H,4-9,12H2,1-3H3,(H2,21,22)/b20-18+ |
| InChIKey | SPTZZAXZUJEIAR-CZIZESTLSA-N |
| XLogP | 3.14 |
| TPSA | 92.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|