C26H32N5O3+ — CID 145290757
[4-[(3aR,7aS)-1-acetyl-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]-6-carboxy-3-(cyclobutanecarboximidoyl)-2-pyridinyl]-phenylazanium (PubChem CID 145290757) has the molecular formula C26H32N5O3+ and a molecular weight of 462.57 g/mol. Its IUPAC name is [4-[(3aR,7aS)-1-acetyl-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]-6-carboxy-3-(cyclobutanecarboximidoyl)-2-pyridinyl]-phenylazanium.
| Compound Name | [4-[(3aR,7aS)-1-acetyl-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]-6-carboxy-3-(cyclobutanecarboximidoyl)-2-pyridinyl]-phenylazanium |
|---|---|
| PubChem CID | 145290757 |
| Molecular Formula | C26H32N5O3+ |
| Molecular Weight | 462.57 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | [4-[(3aR,7aS)-1-acetyl-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]-6-carboxy-3-(cyclobutanecarboximidoyl)-2-pyridinyl]-phenylazanium |
| SMILES | [H]/N=C(/c1c(N2CC[C@H]3[C@H](CCN3C(C)=O)C2)cc(C(=O)O)nc1[NH2+]c1ccccc1)C1CCC1 |
| InChI | InChI=1S/C26H31N5O3/c1-16(32)31-13-10-18-15-30(12-11-21(18)31)22-14-20(26(33)34)29-25(28-19-8-3-2-4-9-19)23(22)24(27)17-6-5-7-17/h2-4,8-9,14,17-18,21,27H,5-7,10-13,15H2,1H3,(H,28,29)(H,33,34)/p+1/b27-24+/t18-,21+/m1/s1 |
| InChIKey | YGZNGTAHZGFJJI-DYKBVYNTSA-O |
| XLogP | 2.92 |
| TPSA | 114.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.57 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|