C23H21F3N2O — CID 159715980
3,6,6-trifluoro-4-(1,2,3,4-tetrahydroisoquinolin-5-yl)-5,7,8,9-tetrahydrofluorene-1-carboxamide (PubChem CID 159715980) has the molecular formula C23H21F3N2O and a molecular weight of 398.43 g/mol. Its IUPAC name is 3,6,6-trifluoro-4-(1,2,3,4-tetrahydroisoquinolin-5-yl)-5,7,8,9-tetrahydrofluorene-1-carboxamide.
| Compound Name | 3,6,6-trifluoro-4-(1,2,3,4-tetrahydroisoquinolin-5-yl)-5,7,8,9-tetrahydrofluorene-1-carboxamide |
|---|---|
| PubChem CID | 159715980 |
| Molecular Formula | C23H21F3N2O |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | 3,6,6-trifluoro-4-(1,2,3,4-tetrahydroisoquinolin-5-yl)-5,7,8,9-tetrahydrofluorene-1-carboxamide |
| SMILES | NC(=O)c1cc(F)c(-c2cccc3c2CCNC3)c2c1CC1=C2CC(F)(F)CC1 |
| InChI | InChI=1S/C23H21F3N2O/c24-19-9-17(22(27)29)16-8-12-4-6-23(25,26)10-18(12)20(16)21(19)15-3-1-2-13-11-28-7-5-14(13)15/h1-3,9,28H,4-8,10-11H2,(H2,27,29) |
| InChIKey | MZKYHCQWWRZEKV-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |