C9H11ClN2O — CID 162338352
2,3-dihydro-1H-isoindole-4-carboxamide;hydrochloride (PubChem CID 162338352) has the molecular formula C9H11ClN2O and a molecular weight of 198.65 g/mol. Its IUPAC name is 2,3-dihydro-1H-isoindole-4-carboxamide;hydrochloride.
| Compound Name | 2,3-dihydro-1H-isoindole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 162338352 |
| Molecular Formula | C9H11ClN2O |
| Molecular Weight | 198.65 g/mol |
| Exact Mass | 198.06 |
| IUPAC Name | 2,3-dihydro-1H-isoindole-4-carboxamide;hydrochloride |
| SMILES | Cl.NC(=O)c1cccc2c1CNC2 |
| InChI | InChI=1S/C9H10N2O.ClH/c10-9(12)7-3-1-2-6-4-11-5-8(6)7;/h1-3,11H,4-5H2,(H2,10,12);1H |
| InChIKey | IDANOZRSDJWKIG-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.65 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |