C23H19FN2O — CID 147953968
3-fluoro-4-(1,2,3,4-tetrahydroisoquinolin-7-yl)-9H-fluorene-1-carboxamide (PubChem CID 147953968) has the molecular formula C23H19FN2O and a molecular weight of 358.42 g/mol. Its IUPAC name is 3-fluoro-4-(1,2,3,4-tetrahydroisoquinolin-7-yl)-9H-fluorene-1-carboxamide.
| Compound Name | 3-fluoro-4-(1,2,3,4-tetrahydroisoquinolin-7-yl)-9H-fluorene-1-carboxamide |
|---|---|
| PubChem CID | 147953968 |
| Molecular Formula | C23H19FN2O |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 3-fluoro-4-(1,2,3,4-tetrahydroisoquinolin-7-yl)-9H-fluorene-1-carboxamide |
| SMILES | NC(=O)c1cc(F)c(-c2ccc3c(c2)CNCC3)c2c1Cc1ccccc1-2 |
| InChI | InChI=1S/C23H19FN2O/c24-20-11-19(23(25)27)18-10-14-3-1-2-4-17(14)22(18)21(20)15-6-5-13-7-8-26-12-16(13)9-15/h1-6,9,11,26H,7-8,10,12H2,(H2,25,27) |
| InChIKey | IODXURPOMZSWRP-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |