C14H17NO2 — CID 138574886
(3E,4E)-3,4-di(ethylidene)-1-[(2E,4Z)-hexa-2,4-dien-3-yl]pyrrolidine-2,5-dione (PubChem CID 138574886) has the molecular formula C14H17NO2 and a molecular weight of 231.29 g/mol. Its IUPAC name is (3E,4E)-3,4-di(ethylidene)-1-[(2E,4Z)-hexa-2,4-dien-3-yl]pyrrolidine-2,5-dione.
| Compound Name | (3E,4E)-3,4-di(ethylidene)-1-[(2E,4Z)-hexa-2,4-dien-3-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 138574886 |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | (3E,4E)-3,4-di(ethylidene)-1-[(2E,4Z)-hexa-2,4-dien-3-yl]pyrrolidine-2,5-dione |
| SMILES | C/C=C\C(=C/C)N1C(=O)C(=C/C)/C(=C\C)C1=O |
| InChI | InChI=1S/C14H17NO2/c1-5-9-10(6-2)15-13(16)11(7-3)12(8-4)14(15)17/h5-9H,1-4H3/b9-5-,10-6+,11-7+,12-8+ |
| InChIKey | JPGMOVAMHKYFLF-GFJZJREDSA-N |
| XLogP | 2.73 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|