C10H13NO2 — CID 90778688
1-propan-2-yl-3-prop-2-enylidenepyrrolidine-2,5-dione (PubChem CID 90778688) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is 1-propan-2-yl-3-prop-2-enylidenepyrrolidine-2,5-dione.
| Compound Name | 1-propan-2-yl-3-prop-2-enylidenepyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 90778688 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 1-propan-2-yl-3-prop-2-enylidenepyrrolidine-2,5-dione |
| SMILES | C=CC=C1CC(=O)N(C(C)C)C1=O |
| InChI | InChI=1S/C10H13NO2/c1-4-5-8-6-9(12)11(7(2)3)10(8)13/h4-5,7H,1,6H2,2-3H3 |
| InChIKey | ALQZHRKLOZICIJ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|