C10H15NO2 — CID 86097288
1-(4-methylpent-3-enyl)pyrrolidine-2,5-dione (PubChem CID 86097288) has the molecular formula C10H15NO2 and a molecular weight of 181.24 g/mol. Its IUPAC name is 1-(4-methylpent-3-enyl)pyrrolidine-2,5-dione.
| Compound Name | 1-(4-methylpent-3-enyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 86097288 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | 1-(4-methylpent-3-enyl)pyrrolidine-2,5-dione |
| SMILES | CC(C)=CCCN1C(=O)CCC1=O |
| InChI | InChI=1S/C10H15NO2/c1-8(2)4-3-7-11-9(12)5-6-10(11)13/h4H,3,5-7H2,1-2H3 |
| InChIKey | RJLLXIJARRVDJT-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|