C19H31NO — CID 6442887
1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]pyrrolidin-2-one (PubChem CID 6442887) has the molecular formula C19H31NO and a molecular weight of 289.46 g/mol. Its IUPAC name is 1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]pyrrolidin-2-one.
| Compound Name | 1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 6442887 |
| Molecular Formula | C19H31NO |
| Molecular Weight | 289.46 g/mol |
| Exact Mass | 289.24 |
| IUPAC Name | 1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]pyrrolidin-2-one |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CN1CCCC1=O |
| InChI | InChI=1S/C19H31NO/c1-16(2)8-5-9-17(3)10-6-11-18(4)13-15-20-14-7-12-19(20)21/h8,10,13H,5-7,9,11-12,14-15H2,1-4H3/b17-10+,18-13+ |
| InChIKey | BFLJGULWRXVLSC-YAUBYZHOSA-N |
| XLogP | 5.03 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.46 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|