C47H34N2O2 — CID 138575970
4-(4-buta-1,3-dien-2-ylphenyl)-2-(8,8-dimethylindeno[1,2-a]oxanthren-1-yl)-6-(4-phenylphenyl)pyrimidine (PubChem CID 138575970) has the molecular formula C47H34N2O2 and a molecular weight of 658.80 g/mol. Its IUPAC name is 4-(4-buta-1,3-dien-2-ylphenyl)-2-(8,8-dimethylindeno[1,2-a]oxanthren-1-yl)-6-(4-phenylphenyl)pyrimidine.
| Compound Name | 4-(4-buta-1,3-dien-2-ylphenyl)-2-(8,8-dimethylindeno[1,2-a]oxanthren-1-yl)-6-(4-phenylphenyl)pyrimidine |
|---|---|
| PubChem CID | 138575970 |
| Molecular Formula | C47H34N2O2 |
| Molecular Weight | 658.80 g/mol |
| Exact Mass | 658.26 |
| IUPAC Name | 4-(4-buta-1,3-dien-2-ylphenyl)-2-(8,8-dimethylindeno[1,2-a]oxanthren-1-yl)-6-(4-phenylphenyl)pyrimidine |
| SMILES | C=CC(=C)c1ccc(-c2cc(-c3ccc(-c4ccccc4)cc3)nc(-c3cccc4c3Oc3c(ccc5c3-c3ccccc3C5(C)C)O4)n2)cc1 |
| InChI | InChI=1S/C47H34N2O2/c1-5-29(2)30-18-22-33(23-19-30)39-28-40(34-24-20-32(21-25-34)31-12-7-6-8-13-31)49-46(48-39)36-15-11-17-41-44(36)51-45-42(50-41)27-26-38-43(45)35-14-9-10-16-37(35)47(38,3)4/h5-28H,1-2H2,3-4H3 |
| InChIKey | XQZHNIZIMFHSNB-UHFFFAOYSA-N |
| XLogP | 12.55 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.80 |
| LogP ≤ 5 | 12.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|