About N-[(3-ethyl-5-methyl-2,3-dihydropyridin-4-yl)methyl]propan-1-amine
N-[(3-ethyl-5-methyl-2,3-dihydropyridin-4-yl)methyl]propan-1-amine (PubChem CID 138576724) has the molecular formula C12H22N2
and a molecular weight of 194.32 g/mol. Its IUPAC name is N-[(3-ethyl-5-methyl-2,3-dihydropyridin-4-yl)methyl]propan-1-amine.
Molecular Properties
| Compound Name | N-[(3-ethyl-5-methyl-2,3-dihydropyridin-4-yl)methyl]propan-1-amine |
| PubChem CID | 138576724 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | N-[(3-ethyl-5-methyl-2,3-dihydropyridin-4-yl)methyl]propan-1-amine |
| SMILES | CCCNCC1=C(C)C=NCC1CC |
| InChI | InChI=1S/C12H22N2/c1-4-6-13-9-12-10(3)7-14-8-11(12)5-2/h7,11,13H,4-6,8-9H2,1-3H3 |
| InChIKey | CPHVYWCQFNFBMA-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[(3-ethyl-5-methyl-2,3-dihydropyridin-4-yl)methyl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3-ethyl-5-methyl-2,3-dihydropyridin-4-yl)methyl]propan-1-amine?
The IUPAC name of N-[(3-ethyl-5-methyl-2,3-dihydropyridin-4-yl)methyl]propan-1-amine (CID 138576724) is N-[(3-ethyl-5-methyl-2,3-dihydropyridin-4-yl)methyl]propan-1-amine.
What is the SMILES notation for N-[(3-ethyl-5-methyl-2,3-dihydropyridin-4-yl)methyl]propan-1-amine?
The canonical SMILES for N-[(3-ethyl-5-methyl-2,3-dihydropyridin-4-yl)methyl]propan-1-amine is CCCNCC1=C(C)C=NCC1CC.
What is the InChIKey of N-[(3-ethyl-5-methyl-2,3-dihydropyridin-4-yl)methyl]propan-1-amine?
The InChIKey is CPHVYWCQFNFBMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2/c1-4-6-13-9-12-10(3)7-14-8-11(12)5-2/h7,11,13H,4-6,8-9H2,1-3H3.
What are the key properties of N-[(3-ethyl-5-methyl-2,3-dihydropyridin-4-yl)methyl]propan-1-amine?
N-[(3-ethyl-5-methyl-2,3-dihydropyridin-4-yl)methyl]propan-1-amine has a molecular weight of 194.32 g/mol, XLogP of 2.41, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3-ethyl-5-methyl-2,3-dihydropyridin-4-yl)methyl]propan-1-amine is sourced from PubChem (CID 138576724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).