C18H20ClNO3 — CID 138578101
methyl (3S)-3-[(3Z,5E)-6-chlorohepta-1,3,5-trien-2-yl]-2,3,4,5-tetrahydro-1,4-benzoxazepine-8-carboxylate (PubChem CID 138578101) has the molecular formula C18H20ClNO3 and a molecular weight of 333.82 g/mol. Its IUPAC name is methyl (3S)-3-[(3Z,5E)-6-chlorohepta-1,3,5-trien-2-yl]-2,3,4,5-tetrahydro-1,4-benzoxazepine-8-carboxylate.
| Compound Name | methyl (3S)-3-[(3Z,5E)-6-chlorohepta-1,3,5-trien-2-yl]-2,3,4,5-tetrahydro-1,4-benzoxazepine-8-carboxylate |
|---|---|
| PubChem CID | 138578101 |
| Molecular Formula | C18H20ClNO3 |
| Molecular Weight | 333.82 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | methyl (3S)-3-[(3Z,5E)-6-chlorohepta-1,3,5-trien-2-yl]-2,3,4,5-tetrahydro-1,4-benzoxazepine-8-carboxylate |
| SMILES | C=C(/C=C\C=C(/C)Cl)[C@H]1COc2cc(C(=O)OC)ccc2CN1 |
| InChI | InChI=1S/C18H20ClNO3/c1-12(5-4-6-13(2)19)16-11-23-17-9-14(18(21)22-3)7-8-15(17)10-20-16/h4-9,16,20H,1,10-11H2,2-3H3/b5-4-,13-6+/t16-/m1/s1 |
| InChIKey | STPWJMTVCFWYAZ-SNMKURDMSA-N |
| XLogP | 3.58 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.82 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|