C22H26N4 — CID 138580015
N-[1-(1-methylpiperidin-4-yl)ethenyl]-6-(2-methyl-3H-pyrrol-4-yl)isoquinolin-3-amine (PubChem CID 138580015) has the molecular formula C22H26N4 and a molecular weight of 346.48 g/mol. Its IUPAC name is N-[1-(1-methylpiperidin-4-yl)ethenyl]-6-(2-methyl-3H-pyrrol-4-yl)isoquinolin-3-amine.
| Compound Name | N-[1-(1-methylpiperidin-4-yl)ethenyl]-6-(2-methyl-3H-pyrrol-4-yl)isoquinolin-3-amine |
|---|---|
| PubChem CID | 138580015 |
| Molecular Formula | C22H26N4 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.22 |
| IUPAC Name | N-[1-(1-methylpiperidin-4-yl)ethenyl]-6-(2-methyl-3H-pyrrol-4-yl)isoquinolin-3-amine |
| SMILES | C=C(Nc1cc2cc(C3=CN=C(C)C3)ccc2cn1)C1CCN(C)CC1 |
| InChI | InChI=1S/C22H26N4/c1-15-10-21(14-23-15)18-4-5-19-13-24-22(12-20(19)11-18)25-16(2)17-6-8-26(3)9-7-17/h4-5,11-14,17H,2,6-10H2,1,3H3,(H,24,25) |
| InChIKey | MMPROEXZKWYVCY-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |