C19H23FIN5 — CID 138580125
2-N,4-N-bis[(1R)-1-cyclopropylethyl]-6-(2-fluoro-5-iodophenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 138580125) has the molecular formula C19H23FIN5 and a molecular weight of 467.33 g/mol. Its IUPAC name is 2-N,4-N-bis[(1R)-1-cyclopropylethyl]-6-(2-fluoro-5-iodophenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,4-N-bis[(1R)-1-cyclopropylethyl]-6-(2-fluoro-5-iodophenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 138580125 |
| Molecular Formula | C19H23FIN5 |
| Molecular Weight | 467.33 g/mol |
| Exact Mass | 467.10 |
| IUPAC Name | 2-N,4-N-bis[(1R)-1-cyclopropylethyl]-6-(2-fluoro-5-iodophenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | C[C@@H](Nc1nc(N[C@H](C)C2CC2)nc(-c2cc(I)ccc2F)n1)C1CC1 |
| InChI | InChI=1S/C19H23FIN5/c1-10(12-3-4-12)22-18-24-17(15-9-14(21)7-8-16(15)20)25-19(26-18)23-11(2)13-5-6-13/h7-13H,3-6H2,1-2H3,(H2,22,23,24,25,26)/t10-,11-/m1/s1 |
| InChIKey | OLYYQNPTQPZGLY-GHMZBOCLSA-N |
| XLogP | 4.70 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.33 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|