C14H27NO — CID 138580671
(NE)-N-(1-cyclohexyl-3,3,4-trimethylpentan-2-ylidene)hydroxylamine (PubChem CID 138580671) has the molecular formula C14H27NO and a molecular weight of 225.38 g/mol. Its IUPAC name is (NE)-N-(1-cyclohexyl-3,3,4-trimethylpentan-2-ylidene)hydroxylamine.
| Compound Name | (NE)-N-(1-cyclohexyl-3,3,4-trimethylpentan-2-ylidene)hydroxylamine |
|---|---|
| PubChem CID | 138580671 |
| Molecular Formula | C14H27NO |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.21 |
| IUPAC Name | (NE)-N-(1-cyclohexyl-3,3,4-trimethylpentan-2-ylidene)hydroxylamine |
| SMILES | CC(C)C(C)(C)/C(CC1CCCCC1)=N/O |
| InChI | InChI=1S/C14H27NO/c1-11(2)14(3,4)13(15-16)10-12-8-6-5-7-9-12/h11-12,16H,5-10H2,1-4H3/b15-13+ |
| InChIKey | NVMANAIRERWQMK-FYWRMAATSA-N |
| XLogP | 4.47 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|