About 2-cyclohexyl-N'-methylethanimidamide
2-cyclohexyl-N'-methylethanimidamide (PubChem CID 130678198) has the molecular formula C9H18N2
and a molecular weight of 154.26 g/mol. Its IUPAC name is 2-cyclohexyl-N'-methylethanimidamide.
Molecular Properties
| Compound Name | 2-cyclohexyl-N'-methylethanimidamide |
| PubChem CID | 130678198 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | 2-cyclohexyl-N'-methylethanimidamide |
| SMILES | C/N=C(\N)CC1CCCCC1 |
| InChI | InChI=1S/C9H18N2/c1-11-9(10)7-8-5-3-2-4-6-8/h8H,2-7H2,1H3,(H2,10,11) |
| InChIKey | BKMWBSKCJARMCX-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclohexyl-N'-methylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexyl-N'-methylethanimidamide?
The IUPAC name of 2-cyclohexyl-N'-methylethanimidamide (CID 130678198) is 2-cyclohexyl-N'-methylethanimidamide.
What is the SMILES notation for 2-cyclohexyl-N'-methylethanimidamide?
The canonical SMILES for 2-cyclohexyl-N'-methylethanimidamide is C/N=C(\N)CC1CCCCC1.
What is the InChIKey of 2-cyclohexyl-N'-methylethanimidamide?
The InChIKey is BKMWBSKCJARMCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2/c1-11-9(10)7-8-5-3-2-4-6-8/h8H,2-7H2,1H3,(H2,10,11).
What are the key properties of 2-cyclohexyl-N'-methylethanimidamide?
2-cyclohexyl-N'-methylethanimidamide has a molecular weight of 154.26 g/mol, XLogP of 1.94, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexyl-N'-methylethanimidamide is sourced from PubChem (CID 130678198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).