About 2-[(N'-cyclohexylcarbamimidoyl)amino]-N'-methylethanimidamide
2-[(N'-cyclohexylcarbamimidoyl)amino]-N'-methylethanimidamide (PubChem CID 176523293) has the molecular formula C10H21N5
and a molecular weight of 211.31 g/mol. Its IUPAC name is 2-[(N'-cyclohexylcarbamimidoyl)amino]-N'-methylethanimidamide.
Molecular Properties
| Compound Name | 2-[(N'-cyclohexylcarbamimidoyl)amino]-N'-methylethanimidamide |
| PubChem CID | 176523293 |
| Molecular Formula | C10H21N5 |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.18 |
| IUPAC Name | 2-[(N'-cyclohexylcarbamimidoyl)amino]-N'-methylethanimidamide |
| SMILES | C/N=C(\N)CN/C(N)=N/C1CCCCC1 |
| InChI | InChI=1S/C10H21N5/c1-13-9(11)7-14-10(12)15-8-5-3-2-4-6-8/h8H,2-7H2,1H3,(H2,11,13)(H3,12,14,15) |
| InChIKey | RAVVSLKDTAHRFL-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 88.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[(N'-cyclohexylcarbamimidoyl)amino]-N'-methylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(N'-cyclohexylcarbamimidoyl)amino]-N'-methylethanimidamide?
The IUPAC name of 2-[(N'-cyclohexylcarbamimidoyl)amino]-N'-methylethanimidamide (CID 176523293) is 2-[(N'-cyclohexylcarbamimidoyl)amino]-N'-methylethanimidamide.
What is the SMILES notation for 2-[(N'-cyclohexylcarbamimidoyl)amino]-N'-methylethanimidamide?
The canonical SMILES for 2-[(N'-cyclohexylcarbamimidoyl)amino]-N'-methylethanimidamide is C/N=C(\N)CN/C(N)=N/C1CCCCC1.
What is the InChIKey of 2-[(N'-cyclohexylcarbamimidoyl)amino]-N'-methylethanimidamide?
The InChIKey is RAVVSLKDTAHRFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21N5/c1-13-9(11)7-14-10(12)15-8-5-3-2-4-6-8/h8H,2-7H2,1H3,(H2,11,13)(H3,12,14,15).
What are the key properties of 2-[(N'-cyclohexylcarbamimidoyl)amino]-N'-methylethanimidamide?
2-[(N'-cyclohexylcarbamimidoyl)amino]-N'-methylethanimidamide has a molecular weight of 211.31 g/mol, XLogP of 0.21, 3 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(N'-cyclohexylcarbamimidoyl)amino]-N'-methylethanimidamide is sourced from PubChem (CID 176523293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).