About 2-cyclopropyl-N'-methylethanimidamide;hydrochloride
2-cyclopropyl-N'-methylethanimidamide;hydrochloride (PubChem CID 146049492) has the molecular formula C6H13ClN2
and a molecular weight of 148.64 g/mol. Its IUPAC name is 2-cyclopropyl-N'-methylethanimidamide;hydrochloride.
Molecular Properties
| Compound Name | 2-cyclopropyl-N'-methylethanimidamide;hydrochloride |
| PubChem CID | 146049492 |
| Molecular Formula | C6H13ClN2 |
| Molecular Weight | 148.64 g/mol |
| Exact Mass | 148.08 |
| IUPAC Name | 2-cyclopropyl-N'-methylethanimidamide;hydrochloride |
| SMILES | C/N=C(\N)CC1CC1.Cl |
| InChI | InChI=1S/C6H12N2.ClH/c1-8-6(7)4-5-2-3-5;/h5H,2-4H2,1H3,(H2,7,8);1H |
| InChIKey | XNVHFKSRMUTFOR-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.64 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclopropyl-N'-methylethanimidamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-N'-methylethanimidamide;hydrochloride?
The IUPAC name of 2-cyclopropyl-N'-methylethanimidamide;hydrochloride (CID 146049492) is 2-cyclopropyl-N'-methylethanimidamide;hydrochloride.
What is the SMILES notation for 2-cyclopropyl-N'-methylethanimidamide;hydrochloride?
The canonical SMILES for 2-cyclopropyl-N'-methylethanimidamide;hydrochloride is C/N=C(\N)CC1CC1.Cl.
What is the InChIKey of 2-cyclopropyl-N'-methylethanimidamide;hydrochloride?
The InChIKey is XNVHFKSRMUTFOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2.ClH/c1-8-6(7)4-5-2-3-5;/h5H,2-4H2,1H3,(H2,7,8);1H.
What are the key properties of 2-cyclopropyl-N'-methylethanimidamide;hydrochloride?
2-cyclopropyl-N'-methylethanimidamide;hydrochloride has a molecular weight of 148.64 g/mol, XLogP of 1.20, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-N'-methylethanimidamide;hydrochloride is sourced from PubChem (CID 146049492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).