C6H15ClN2 — CID 141307691
N',3-dimethylbutanimidamide;hydrochloride (PubChem CID 141307691) has the molecular formula C6H15ClN2 and a molecular weight of 150.65 g/mol. Its IUPAC name is N',3-dimethylbutanimidamide;hydrochloride.
| Compound Name | N',3-dimethylbutanimidamide;hydrochloride |
|---|---|
| PubChem CID | 141307691 |
| Molecular Formula | C6H15ClN2 |
| Molecular Weight | 150.65 g/mol |
| Exact Mass | 150.09 |
| IUPAC Name | N',3-dimethylbutanimidamide;hydrochloride |
| SMILES | C/N=C(\N)CC(C)C.Cl |
| InChI | InChI=1S/C6H14N2.ClH/c1-5(2)4-6(7)8-3;/h5H,4H2,1-3H3,(H2,7,8);1H |
| InChIKey | JFJMFRWKHBAPIV-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.65 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|