C20H26N6O3S — CID 138581050
5-[5-[(4-hydroxy-1-bicyclo[2.2.1]heptanyl)sulfamoyl]-2-methylphenyl]-N'-methyl-1-(methylideneamino)imidazole-2-carboximidamide (PubChem CID 138581050) has the molecular formula C20H26N6O3S and a molecular weight of 430.53 g/mol. Its IUPAC name is 5-[5-[(4-hydroxy-1-bicyclo[2.2.1]heptanyl)sulfamoyl]-2-methylphenyl]-N'-methyl-1-(methylideneamino)imidazole-2-carboximidamide.
| Compound Name | 5-[5-[(4-hydroxy-1-bicyclo[2.2.1]heptanyl)sulfamoyl]-2-methylphenyl]-N'-methyl-1-(methylideneamino)imidazole-2-carboximidamide |
|---|---|
| PubChem CID | 138581050 |
| Molecular Formula | C20H26N6O3S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | 5-[5-[(4-hydroxy-1-bicyclo[2.2.1]heptanyl)sulfamoyl]-2-methylphenyl]-N'-methyl-1-(methylideneamino)imidazole-2-carboximidamide |
| SMILES | C=Nn1c(-c2cc(S(=O)(=O)NC34CCC(O)(CC3)C4)ccc2C)cnc1/C(N)=N/C |
| InChI | InChI=1S/C20H26N6O3S/c1-13-4-5-14(30(28,29)25-19-6-8-20(27,12-19)9-7-19)10-15(13)16-11-24-18(17(21)22-2)26(16)23-3/h4-5,10-11,25,27H,3,6-9,12H2,1-2H3,(H2,21,22) |
| InChIKey | ZFNLBBJOYMRTOH-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 134.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|