C19H19N7O2S — CID 140831773
3-(4-aminoimidazo[2,1-f][1,2,4]triazin-7-yl)-N-(4-isocyano-1-bicyclo[2.1.1]hexanyl)-4-methylbenzenesulfonamide (PubChem CID 140831773) has the molecular formula C19H19N7O2S and a molecular weight of 409.48 g/mol. Its IUPAC name is 3-(4-aminoimidazo[2,1-f][1,2,4]triazin-7-yl)-N-(4-isocyano-1-bicyclo[2.1.1]hexanyl)-4-methylbenzenesulfonamide.
| Compound Name | 3-(4-aminoimidazo[2,1-f][1,2,4]triazin-7-yl)-N-(4-isocyano-1-bicyclo[2.1.1]hexanyl)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 140831773 |
| Molecular Formula | C19H19N7O2S |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | 3-(4-aminoimidazo[2,1-f][1,2,4]triazin-7-yl)-N-(4-isocyano-1-bicyclo[2.1.1]hexanyl)-4-methylbenzenesulfonamide |
| SMILES | [C-]#[N+]C12CCC(NS(=O)(=O)c3ccc(C)c(-c4cnc5c(N)ncnn45)c3)(C1)C2 |
| InChI | InChI=1S/C19H19N7O2S/c1-12-3-4-13(29(27,28)25-19-6-5-18(9-19,10-19)21-2)7-14(12)15-8-22-17-16(20)23-11-24-26(15)17/h3-4,7-8,11,25H,5-6,9-10H2,1H3,(H2,20,23,24) |
| InChIKey | IPRYXRRDRZWHQV-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 119.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|